C11H26N4O — CID 54422986
(2S)-2,6-diamino-N-[1-(dimethylamino)propyl]hexanamide (PubChem CID 54422986) has the molecular formula C11H26N4O and a molecular weight of 230.36 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[1-(dimethylamino)propyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[1-(dimethylamino)propyl]hexanamide |
|---|---|
| PubChem CID | 54422986 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | (2S)-2,6-diamino-N-[1-(dimethylamino)propyl]hexanamide |
| SMILES | CCC(NC(=O)[C@@H](N)CCCCN)N(C)C |
| InChI | InChI=1S/C11H26N4O/c1-4-10(15(2)3)14-11(16)9(13)7-5-6-8-12/h9-10H,4-8,12-13H2,1-3H3,(H,14,16)/t9-,10?/m0/s1 |
| InChIKey | WCCBMIMQQOMHRE-RGURZIINSA-N |
| XLogP | -0.14 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|