About (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine
(Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine (PubChem CID 170126340) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine |
| PubChem CID | 170126340 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine |
| SMILES | C/C=C\N/C=C\N(C)C(C)C |
| InChI | InChI=1S/C9H18N2/c1-5-6-10-7-8-11(4)9(2)3/h5-10H,1-4H3/b6-5-,8-7- |
| InChIKey | XZMNGMYOADQBNH-ISTTXYCBSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine?
The IUPAC name of (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine (CID 170126340) is (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine.
What is the SMILES notation for (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine?
The canonical SMILES for (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine is C/C=C\N/C=C\N(C)C(C)C.
What is the InChIKey of (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine?
The InChIKey is XZMNGMYOADQBNH-ISTTXYCBSA-N. The full InChI is InChI=1S/C9H18N2/c1-5-6-10-7-8-11(4)9(2)3/h5-10H,1-4H3/b6-5-,8-7-.
What are the key properties of (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine?
(Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine has a molecular weight of 154.26 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-methyl-N'-propan-2-yl-N-[(Z)-prop-1-enyl]ethene-1,2-diamine is sourced from PubChem (CID 170126340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).