C10H19N — CID 143682568
(1E)-N-methyl-N-propan-2-ylhexa-1,5-dien-1-amine (PubChem CID 143682568) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (1E)-N-methyl-N-propan-2-ylhexa-1,5-dien-1-amine.
| Compound Name | (1E)-N-methyl-N-propan-2-ylhexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 143682568 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (1E)-N-methyl-N-propan-2-ylhexa-1,5-dien-1-amine |
| SMILES | C=CCC/C=C/N(C)C(C)C |
| InChI | InChI=1S/C10H19N/c1-5-6-7-8-9-11(4)10(2)3/h5,8-10H,1,6-7H2,2-4H3/b9-8+ |
| InChIKey | KKWNXTQCUTULCZ-CMDGGOBGSA-N |
| XLogP | 2.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|