C10H18 — CID 54303226
8-methylnona-1,5-diene (PubChem CID 54303226) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is 8-methylnona-1,5-diene.
| Compound Name | 8-methylnona-1,5-diene |
|---|---|
| PubChem CID | 54303226 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | 8-methylnona-1,5-diene |
| SMILES | C=CCCC=CCC(C)C |
| InChI | InChI=1S/C10H18/c1-4-5-6-7-8-9-10(2)3/h4,7-8,10H,1,5-6,9H2,2-3H3 |
| InChIKey | SFRRSOGSXKZDHA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|