C20H42 — CID 158518430
butane;2,7-dimethyloct-4-ene;4-methylpent-1-ene (PubChem CID 158518430) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is butane;2,7-dimethyloct-4-ene;4-methylpent-1-ene.
| Compound Name | butane;2,7-dimethyloct-4-ene;4-methylpent-1-ene |
|---|---|
| PubChem CID | 158518430 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | butane;2,7-dimethyloct-4-ene;4-methylpent-1-ene |
| SMILES | C=CCC(C)C.CC(C)CC=CCC(C)C.CCCC |
| InChI | InChI=1S/C10H20.C6H12.C4H10/c1-9(2)7-5-6-8-10(3)4;1-4-5-6(2)3;1-3-4-2/h5-6,9-10H,7-8H2,1-4H3;4,6H,1,5H2,2-3H3;3-4H2,1-2H3 |
| InChIKey | HLXKWFVAYRGCOY-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|