About bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene
bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene (PubChem CID 158440590) has the molecular formula C24H52O
and a molecular weight of 356.68 g/mol. Its IUPAC name is bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene.
Molecular Properties
| Compound Name | bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene |
| PubChem CID | 158440590 |
| Molecular Formula | C24H52O |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 356.40 |
| IUPAC Name | bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene |
| SMILES | C=CCC(C)C.CC(=O)CC(C)C.CCCC(C)C.CCCC(C)C |
| InChI | InChI=1S/C6H12O.2C6H14.C6H12/c1-5(2)4-6(3)7;3*1-4-5-6(2)3/h5H,4H2,1-3H3;2*6H,4-5H2,1-3H3;4,6H,1,5H2,2-3H3 |
| InChIKey | HCTLWTFMYFIBEC-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene?
The IUPAC name of bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene (CID 158440590) is bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene.
What is the SMILES notation for bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene?
The canonical SMILES for bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene is C=CCC(C)C.CC(=O)CC(C)C.CCCC(C)C.CCCC(C)C.
What is the InChIKey of bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene?
The InChIKey is HCTLWTFMYFIBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.2C6H14.C6H12/c1-5(2)4-6(3)7;3*1-4-5-6(2)3/h5H,4H2,1-3H3;2*6H,4-5H2,1-3H3;4,6H,1,5H2,2-3H3.
What are the key properties of bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene?
bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene has a molecular weight of 356.68 g/mol, XLogP of 8.73, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpentane);4-methylpentan-2-one;4-methylpent-1-ene is sourced from PubChem (CID 158440590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).