About ethanol;4-methylpent-1-ene
ethanol;4-methylpent-1-ene (PubChem CID 141289447) has the molecular formula C8H18O
and a molecular weight of 130.23 g/mol. Its IUPAC name is ethanol;4-methylpent-1-ene.
Molecular Properties
| Compound Name | ethanol;4-methylpent-1-ene |
| PubChem CID | 141289447 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | ethanol;4-methylpent-1-ene |
| SMILES | C=CCC(C)C.CCO |
| InChI | InChI=1S/C6H12.C2H6O/c1-4-5-6(2)3;1-2-3/h4,6H,1,5H2,2-3H3;3H,2H2,1H3 |
| InChIKey | RUZVBSTUQJNVBY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethanol;4-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;4-methylpent-1-ene?
The IUPAC name of ethanol;4-methylpent-1-ene (CID 141289447) is ethanol;4-methylpent-1-ene.
What is the SMILES notation for ethanol;4-methylpent-1-ene?
The canonical SMILES for ethanol;4-methylpent-1-ene is C=CCC(C)C.CCO.
What is the InChIKey of ethanol;4-methylpent-1-ene?
The InChIKey is RUZVBSTUQJNVBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C2H6O/c1-4-5-6(2)3;1-2-3/h4,6H,1,5H2,2-3H3;3H,2H2,1H3.
What are the key properties of ethanol;4-methylpent-1-ene?
ethanol;4-methylpent-1-ene has a molecular weight of 130.23 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;4-methylpent-1-ene is sourced from PubChem (CID 141289447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).