C14H26 — CID 173298827
8-methylnona-1,5-diene;2-methylprop-1-ene (PubChem CID 173298827) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 8-methylnona-1,5-diene;2-methylprop-1-ene.
| Compound Name | 8-methylnona-1,5-diene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 173298827 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 8-methylnona-1,5-diene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CCCC=CCC(C)C |
| InChI | InChI=1S/C10H18.C4H8/c1-4-5-6-7-8-9-10(2)3;1-4(2)3/h4,7-8,10H,1,5-6,9H2,2-3H3;1H2,2-3H3 |
| InChIKey | ZWDSEEZLYQDWJD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|