C11H15N — CID 163917439
(1Z,3Z)-N-[(1Z)-buta-1,3-dienyl]-N-methylhexa-1,3,5-trien-1-amine (PubChem CID 163917439) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (1Z,3Z)-N-[(1Z)-buta-1,3-dienyl]-N-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N-[(1Z)-buta-1,3-dienyl]-N-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 163917439 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (1Z,3Z)-N-[(1Z)-buta-1,3-dienyl]-N-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C=C/N(C)/C=C\C=C |
| InChI | InChI=1S/C11H15N/c1-4-6-8-9-11-12(3)10-7-5-2/h4-11H,1-2H2,3H3/b8-6-,10-7-,11-9- |
| InChIKey | QXMDAHFKFZRLAW-NCKVKMDVSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|