C8H13IN2 — CID 134482442
(Z)-N-[(3Z)-4-iodobuta-1,3-dien-2-yl]-N',N'-dimethylethene-1,2-diamine (PubChem CID 134482442) has the molecular formula C8H13IN2 and a molecular weight of 264.11 g/mol. Its IUPAC name is (Z)-N-[(3Z)-4-iodobuta-1,3-dien-2-yl]-N',N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N-[(3Z)-4-iodobuta-1,3-dien-2-yl]-N',N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 134482442 |
| Molecular Formula | C8H13IN2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (Z)-N-[(3Z)-4-iodobuta-1,3-dien-2-yl]-N',N'-dimethylethene-1,2-diamine |
| SMILES | C=C(/C=C\I)N/C=C\N(C)C |
| InChI | InChI=1S/C8H13IN2/c1-8(4-5-9)10-6-7-11(2)3/h4-7,10H,1H2,2-3H3/b5-4-,7-6- |
| InChIKey | SYCSUQFFHUOXJS-RZSVFLSASA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|