C11H17NS — CID 129144376
(3Z,5E)-5-methylsulfanyl-N-[(E)-prop-1-enyl]hepta-1,3,5-trien-2-amine (PubChem CID 129144376) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is (3Z,5E)-5-methylsulfanyl-N-[(E)-prop-1-enyl]hepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-5-methylsulfanyl-N-[(E)-prop-1-enyl]hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 129144376 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (3Z,5E)-5-methylsulfanyl-N-[(E)-prop-1-enyl]hepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C/C)SC)N/C=C/C |
| InChI | InChI=1S/C11H17NS/c1-5-9-12-10(3)7-8-11(6-2)13-4/h5-9,12H,3H2,1-2,4H3/b8-7-,9-5+,11-6+ |
| InChIKey | DPEGEWIXVLFKKZ-TWFQKEQASA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|