C8H23N3Si2 — CID 153472996
N,N-bis[dimethylamino(methyl)silyl]ethenamine (PubChem CID 153472996) has the molecular formula C8H23N3Si2 and a molecular weight of 217.46 g/mol. Its IUPAC name is N,N-bis[dimethylamino(methyl)silyl]ethenamine.
| Compound Name | N,N-bis[dimethylamino(methyl)silyl]ethenamine |
|---|---|
| PubChem CID | 153472996 |
| Molecular Formula | C8H23N3Si2 |
| Molecular Weight | 217.46 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N,N-bis[dimethylamino(methyl)silyl]ethenamine |
| SMILES | C=CN([SiH](C)N(C)C)[SiH](C)N(C)C |
| InChI | InChI=1S/C8H23N3Si2/c1-8-11(12(6)9(2)3)13(7)10(4)5/h8,12-13H,1H2,2-7H3 |
| InChIKey | WXNWRHGMTOYGBT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.46 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|