C6H15NO2 — CID 88731218
N,N-dimethylethenamine;ethane-1,2-diol (PubChem CID 88731218) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is N,N-dimethylethenamine;ethane-1,2-diol.
| Compound Name | N,N-dimethylethenamine;ethane-1,2-diol |
|---|---|
| PubChem CID | 88731218 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | N,N-dimethylethenamine;ethane-1,2-diol |
| SMILES | C=CN(C)C.OCCO |
| InChI | InChI=1S/C4H9N.C2H6O2/c1-4-5(2)3;3-1-2-4/h4H,1H2,2-3H3;3-4H,1-2H2 |
| InChIKey | KNYYRSSAYZUSTQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |