About ethane-1,2-diol;propan-2-ol;prop-1-ene
ethane-1,2-diol;propan-2-ol;prop-1-ene (PubChem CID 87786416) has the molecular formula C8H20O3
and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane-1,2-diol;propan-2-ol;prop-1-ene.
Molecular Properties
| Compound Name | ethane-1,2-diol;propan-2-ol;prop-1-ene |
| PubChem CID | 87786416 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | ethane-1,2-diol;propan-2-ol;prop-1-ene |
| SMILES | C=CC.CC(C)O.OCCO |
| InChI | InChI=1S/C3H8O.C3H6.C2H6O2/c1-3(2)4;1-3-2;3-1-2-4/h3-4H,1-2H3;3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | DMWSHGLVVRTNEG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;propan-2-ol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;propan-2-ol;prop-1-ene?
The IUPAC name of ethane-1,2-diol;propan-2-ol;prop-1-ene (CID 87786416) is ethane-1,2-diol;propan-2-ol;prop-1-ene.
What is the SMILES notation for ethane-1,2-diol;propan-2-ol;prop-1-ene?
The canonical SMILES for ethane-1,2-diol;propan-2-ol;prop-1-ene is C=CC.CC(C)O.OCCO.
What is the InChIKey of ethane-1,2-diol;propan-2-ol;prop-1-ene?
The InChIKey is DMWSHGLVVRTNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.C3H6.C2H6O2/c1-3(2)4;1-3-2;3-1-2-4/h3-4H,1-2H3;3H,1H2,2H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;propan-2-ol;prop-1-ene?
ethane-1,2-diol;propan-2-ol;prop-1-ene has a molecular weight of 164.25 g/mol, XLogP of 0.55, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;propan-2-ol;prop-1-ene is sourced from PubChem (CID 87786416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).