C8H20O3 — CID 87786416
ethane-1,2-diol;propan-2-ol;prop-1-ene (PubChem CID 87786416) has the molecular formula C8H20O3 and a molecular weight of 164.25 g/mol. Its IUPAC name is ethane-1,2-diol;propan-2-ol;prop-1-ene.
| Compound Name | ethane-1,2-diol;propan-2-ol;prop-1-ene |
|---|---|
| PubChem CID | 87786416 |
| Molecular Formula | C8H20O3 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.14 |
| IUPAC Name | ethane-1,2-diol;propan-2-ol;prop-1-ene |
| SMILES | C=CC.CC(C)O.OCCO |
| InChI | InChI=1S/C3H8O.C3H6.C2H6O2/c1-3(2)4;1-3-2;3-1-2-4/h3-4H,1-2H3;3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | DMWSHGLVVRTNEG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|