C13H30O3 — CID 142161080
ethane;(2S)-2-methylheptane-1,3,7-triol;prop-1-ene (PubChem CID 142161080) has the molecular formula C13H30O3 and a molecular weight of 234.38 g/mol. Its IUPAC name is ethane;(2S)-2-methylheptane-1,3,7-triol;prop-1-ene.
| Compound Name | ethane;(2S)-2-methylheptane-1,3,7-triol;prop-1-ene |
|---|---|
| PubChem CID | 142161080 |
| Molecular Formula | C13H30O3 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | ethane;(2S)-2-methylheptane-1,3,7-triol;prop-1-ene |
| SMILES | C=CC.CC.C[C@@H](CO)C(O)CCCCO |
| InChI | InChI=1S/C8H18O3.C3H6.C2H6/c1-7(6-10)8(11)4-2-3-5-9;1-3-2;1-2/h7-11H,2-6H2,1H3;3H,1H2,2H3;1-2H3/t7-,8?;;/m0../s1 |
| InChIKey | BCIYIBYFMQUVNG-LYJMGTGMSA-N |
| XLogP | 2.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|