C5H10N2 — CID 174001466
1-N'-ethenyl-1-N'-methylethene-1,1-diamine (PubChem CID 174001466) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 1-N'-ethenyl-1-N'-methylethene-1,1-diamine.
| Compound Name | 1-N'-ethenyl-1-N'-methylethene-1,1-diamine |
|---|---|
| PubChem CID | 174001466 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1-N'-ethenyl-1-N'-methylethene-1,1-diamine |
| SMILES | C=CN(C)C(=C)N |
| InChI | InChI=1S/C5H10N2/c1-4-7(3)5(2)6/h4H,1-2,6H2,3H3 |
| InChIKey | MHEPFWFYCDXFOK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |