C12H20N2 — CID 174245993
(2Z,3E)-1-N-ethenyl-2,3-di(ethylidene)-1-N-methylpent-4-ene-1,4-diamine (PubChem CID 174245993) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2Z,3E)-1-N-ethenyl-2,3-di(ethylidene)-1-N-methylpent-4-ene-1,4-diamine.
| Compound Name | (2Z,3E)-1-N-ethenyl-2,3-di(ethylidene)-1-N-methylpent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 174245993 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2Z,3E)-1-N-ethenyl-2,3-di(ethylidene)-1-N-methylpent-4-ene-1,4-diamine |
| SMILES | C=CN(C)CC(=C\C)/C(=C\C)C(=C)N |
| InChI | InChI=1S/C12H20N2/c1-6-11(9-14(5)8-3)12(7-2)10(4)13/h6-8H,3-4,9,13H2,1-2,5H3/b11-6+,12-7- |
| InChIKey | VCQUWBMZWFURDB-CZIBKUHYSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|