C11H19N — CID 134566444
(2E,4Z)-N-ethenyl-N,2,3-trimethylhexa-2,4-dien-1-amine (PubChem CID 134566444) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E,4Z)-N-ethenyl-N,2,3-trimethylhexa-2,4-dien-1-amine.
| Compound Name | (2E,4Z)-N-ethenyl-N,2,3-trimethylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134566444 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E,4Z)-N-ethenyl-N,2,3-trimethylhexa-2,4-dien-1-amine |
| SMILES | C=CN(C)C/C(C)=C(C)/C=C\C |
| InChI | InChI=1S/C11H19N/c1-6-8-10(3)11(4)9-12(5)7-2/h6-8H,2,9H2,1,3-5H3/b8-6-,11-10+ |
| InChIKey | COSOZVJWYSHEQR-FEVLKHHISA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|