C15H27N — CID 134580456
(2Z,4E,6Z)-N-(2,2-dimethylpropyl)-N,5-dimethylocta-2,4,6-trien-4-amine (PubChem CID 134580456) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (2Z,4E,6Z)-N-(2,2-dimethylpropyl)-N,5-dimethylocta-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6Z)-N-(2,2-dimethylpropyl)-N,5-dimethylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 134580456 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2Z,4E,6Z)-N-(2,2-dimethylpropyl)-N,5-dimethylocta-2,4,6-trien-4-amine |
| SMILES | C/C=C\C(C)=C(/C=C\C)N(C)CC(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-8-10-13(3)14(11-9-2)16(7)12-15(4,5)6/h8-11H,12H2,1-7H3/b10-8-,11-9-,14-13+ |
| InChIKey | MZQZLMTUWIHLND-KUMKROPXSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|