C10H22N4 — CID 87279008
N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide (PubChem CID 87279008) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide.
| Compound Name | N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide |
|---|---|
| PubChem CID | 87279008 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide |
| SMILES | [H]/N=C/N=C(\N(C)C)N(C)CC(C)(C)C |
| InChI | InChI=1S/C10H22N4/c1-10(2,3)7-14(6)9(12-8-11)13(4)5/h8,11H,7H2,1-6H3/b11-8+,12-9+ |
| InChIKey | ALDXRVJBQJSQFH-HZOWPXDZSA-N |
| XLogP | 1.49 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|