About N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide
N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide (PubChem CID 87279008) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide.
Molecular Properties
| Compound Name | N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide |
| PubChem CID | 87279008 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide |
| SMILES | [H]/N=C/N=C(\N(C)C)N(C)CC(C)(C)C |
| InChI | InChI=1S/C10H22N4/c1-10(2,3)7-14(6)9(12-8-11)13(4)5/h8,11H,7H2,1-6H3/b11-8+,12-9+ |
| InChIKey | ALDXRVJBQJSQFH-HZOWPXDZSA-N |
| XLogP | 1.49 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide?
The IUPAC name of N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide (CID 87279008) is N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide.
What is the SMILES notation for N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide?
The canonical SMILES for N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide is [H]/N=C/N=C(\N(C)C)N(C)CC(C)(C)C.
What is the InChIKey of N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide?
The InChIKey is ALDXRVJBQJSQFH-HZOWPXDZSA-N. The full InChI is InChI=1S/C10H22N4/c1-10(2,3)7-14(6)9(12-8-11)13(4)5/h8,11H,7H2,1-6H3/b11-8+,12-9+.
What are the key properties of N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide?
N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide has a molecular weight of 198.31 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethylamino-[2,2-dimethylpropyl(methyl)amino]methylidene]methanimidamide is sourced from PubChem (CID 87279008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).