C9H17NO3 — CID 62232473
3-[2,2-dimethylpropyl(methyl)amino]-3-oxopropanoic acid (PubChem CID 62232473) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-[2,2-dimethylpropyl(methyl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[2,2-dimethylpropyl(methyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62232473 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 3-[2,2-dimethylpropyl(methyl)amino]-3-oxopropanoic acid |
| SMILES | CN(CC(C)(C)C)C(=O)CC(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)6-10(4)7(11)5-8(12)13/h5-6H2,1-4H3,(H,12,13) |
| InChIKey | RYYZCFAMLZZOSS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|