C9H17LiO4 — CID 158478017
lithium;2,2-dimethylbutane;propanedioic acid (PubChem CID 158478017) has the molecular formula C9H17LiO4 and a molecular weight of 196.17 g/mol. Its IUPAC name is lithium;2,2-dimethylbutane;propanedioic acid.
| Compound Name | lithium;2,2-dimethylbutane;propanedioic acid |
|---|---|
| PubChem CID | 158478017 |
| Molecular Formula | C9H17LiO4 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | lithium;2,2-dimethylbutane;propanedioic acid |
| SMILES | C[CH-]C(C)(C)C.O=C(O)CC(=O)O.[Li+] |
| InChI | InChI=1S/C6H13.C3H4O4.Li/c1-5-6(2,3)4;4-2(5)1-3(6)7;/h5H,1-4H3;1H2,(H,4,5)(H,6,7);/q-1;;+1 |
| InChIKey | KCUNSRAIEMGFDE-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|