C12H26N2O — CID 110669430
1,3-bis(2,2-dimethylpropyl)-1-methylurea (PubChem CID 110669430) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,3-bis(2,2-dimethylpropyl)-1-methylurea.
| Compound Name | 1,3-bis(2,2-dimethylpropyl)-1-methylurea |
|---|---|
| PubChem CID | 110669430 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,3-bis(2,2-dimethylpropyl)-1-methylurea |
| SMILES | CN(CC(C)(C)C)C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-11(2,3)8-13-10(15)14(7)9-12(4,5)6/h8-9H2,1-7H3,(H,13,15) |
| InChIKey | LJEHJCFTMUVTFF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |