About 1,3-bis(2,2-dimethylpropyl)-1-methylurea
1,3-bis(2,2-dimethylpropyl)-1-methylurea (PubChem CID 110669430) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,3-bis(2,2-dimethylpropyl)-1-methylurea.
Molecular Properties
| Compound Name | 1,3-bis(2,2-dimethylpropyl)-1-methylurea |
| PubChem CID | 110669430 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,3-bis(2,2-dimethylpropyl)-1-methylurea |
| SMILES | CN(CC(C)(C)C)C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-11(2,3)8-13-10(15)14(7)9-12(4,5)6/h8-9H2,1-7H3,(H,13,15) |
| InChIKey | LJEHJCFTMUVTFF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(2,2-dimethylpropyl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,2-dimethylpropyl)-1-methylurea?
The IUPAC name of 1,3-bis(2,2-dimethylpropyl)-1-methylurea (CID 110669430) is 1,3-bis(2,2-dimethylpropyl)-1-methylurea.
What is the SMILES notation for 1,3-bis(2,2-dimethylpropyl)-1-methylurea?
The canonical SMILES for 1,3-bis(2,2-dimethylpropyl)-1-methylurea is CN(CC(C)(C)C)C(=O)NCC(C)(C)C.
What is the InChIKey of 1,3-bis(2,2-dimethylpropyl)-1-methylurea?
The InChIKey is LJEHJCFTMUVTFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-11(2,3)8-13-10(15)14(7)9-12(4,5)6/h8-9H2,1-7H3,(H,13,15).
What are the key properties of 1,3-bis(2,2-dimethylpropyl)-1-methylurea?
1,3-bis(2,2-dimethylpropyl)-1-methylurea has a molecular weight of 214.35 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,2-dimethylpropyl)-1-methylurea is sourced from PubChem (CID 110669430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).