C11H17N — CID 142987567
(3E,5Z)-N-ethenyl-N,3-dimethylhepta-1,3,5-trien-4-amine (PubChem CID 142987567) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3E,5Z)-N-ethenyl-N,3-dimethylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-N-ethenyl-N,3-dimethylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 142987567 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3E,5Z)-N-ethenyl-N,3-dimethylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(C)=C(\C=C/C)N(C)C=C |
| InChI | InChI=1S/C11H17N/c1-6-9-11(10(4)7-2)12(5)8-3/h6-9H,2-3H2,1,4-5H3/b9-6-,11-10+ |
| InChIKey | CGFLWAOVTRFLQS-KBCDKWTQSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|