C12H19N — CID 162762569
(3Z,5Z)-N-ethyl-N,3-dimethylocta-1,3,5,7-tetraen-4-amine (PubChem CID 162762569) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3Z,5Z)-N-ethyl-N,3-dimethylocta-1,3,5,7-tetraen-4-amine.
| Compound Name | (3Z,5Z)-N-ethyl-N,3-dimethylocta-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 162762569 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3Z,5Z)-N-ethyl-N,3-dimethylocta-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C(/C)C=C)N(C)CC |
| InChI | InChI=1S/C12H19N/c1-6-9-10-12(11(4)7-2)13(5)8-3/h6-7,9-10H,1-2,8H2,3-5H3/b10-9-,12-11- |
| InChIKey | QPHLNHKUTXPPIY-BASFJDSNSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|