C10H18N2 — CID 142864476
(3Z,5Z)-3-N-ethyl-3-N-methylhepta-1,3,5-triene-3,4-diamine (PubChem CID 142864476) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3Z,5Z)-3-N-ethyl-3-N-methylhepta-1,3,5-triene-3,4-diamine.
| Compound Name | (3Z,5Z)-3-N-ethyl-3-N-methylhepta-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 142864476 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3Z,5Z)-3-N-ethyl-3-N-methylhepta-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(=C(N)\C=C/C)N(C)CC |
| InChI | InChI=1S/C10H18N2/c1-5-8-9(11)10(6-2)12(4)7-3/h5-6,8H,2,7,11H2,1,3-4H3/b8-5-,10-9- |
| InChIKey | SJCUWCRGBXVUGM-IVXNCWGASA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|