C11H22N2O — CID 143245749
(2Z,4Z)-5-[2-(dimethylamino)ethoxy]hepta-2,4-dien-4-amine (PubChem CID 143245749) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (2Z,4Z)-5-[2-(dimethylamino)ethoxy]hepta-2,4-dien-4-amine.
| Compound Name | (2Z,4Z)-5-[2-(dimethylamino)ethoxy]hepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 143245749 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2Z,4Z)-5-[2-(dimethylamino)ethoxy]hepta-2,4-dien-4-amine |
| SMILES | C/C=C\C(N)=C(/CC)OCCN(C)C |
| InChI | InChI=1S/C11H22N2O/c1-5-7-10(12)11(6-2)14-9-8-13(3)4/h5,7H,6,8-9,12H2,1-4H3/b7-5-,11-10- |
| InChIKey | LHRREXNZCPUMFY-YLRXWAGNSA-N |
| XLogP | 1.72 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|