C10H15N — CID 170027215
(2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-amine (PubChem CID 170027215) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 170027215 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-amine |
| SMILES | C=CC(/C=C\C)=C(N)/C=C\C |
| InChI | InChI=1S/C10H15N/c1-4-7-9(6-3)10(11)8-5-2/h4-8H,3,11H2,1-2H3/b7-4-,8-5-,10-9+ |
| InChIKey | GGZMIZBWMOITOK-VRLBFYMBSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|