C11H14 — CID 142110830
(5E)-3,4-bis(ethenyl)hepta-1,3,5-triene (PubChem CID 142110830) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene.
| Compound Name | (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 142110830 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene |
| SMILES | C=CC(C=C)=C(C=C)/C=C/C |
| InChI | InChI=1S/C11H14/c1-5-9-11(8-4)10(6-2)7-3/h5-9H,2-4H2,1H3/b9-5+ |
| InChIKey | WPLQQYQTSWHQPE-WEVVVXLNSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|