C12H20 — CID 144517044
(2Z,4Z,6Z)-4-methyl-5-propylocta-2,4,6-triene (PubChem CID 144517044) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (2Z,4Z,6Z)-4-methyl-5-propylocta-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-4-methyl-5-propylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144517044 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (2Z,4Z,6Z)-4-methyl-5-propylocta-2,4,6-triene |
| SMILES | C/C=C\C(C)=C(/C=C\C)CCC |
| InChI | InChI=1S/C12H20/c1-5-8-11(4)12(9-6-2)10-7-3/h5-6,8-9H,7,10H2,1-4H3/b8-5-,9-6-,12-11+ |
| InChIKey | PTNMZDMYLRZVGB-HNNSWSEXSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|