C12H22O — CID 143682761
ethane;(3E,5Z)-4-propylhepta-1,3,5-trien-3-ol (PubChem CID 143682761) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-propylhepta-1,3,5-trien-3-ol.
| Compound Name | ethane;(3E,5Z)-4-propylhepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 143682761 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | ethane;(3E,5Z)-4-propylhepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(\C=C/C)CCC.CC |
| InChI | InChI=1S/C10H16O.C2H6/c1-4-7-9(8-5-2)10(11)6-3;1-2/h4,6-7,11H,3,5,8H2,1-2H3;1-2H3/b7-4-,10-9-; |
| InChIKey | MNEQVPCTNPRQOM-DBDVFUPWSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|