C7H12O2 — CID 140987988
hepta-1,3-diene-3,4-diol (PubChem CID 140987988) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is hepta-1,3-diene-3,4-diol.
| Compound Name | hepta-1,3-diene-3,4-diol |
|---|---|
| PubChem CID | 140987988 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | hepta-1,3-diene-3,4-diol |
| SMILES | C=CC(O)=C(O)CCC |
| InChI | InChI=1S/C7H12O2/c1-3-5-7(9)6(8)4-2/h4,8-9H,2-3,5H2,1H3 |
| InChIKey | VRXMQYIYLDUOSN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|