C11H19N — CID 142099496
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine (PubChem CID 142099496) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine |
|---|---|
| PubChem CID | 142099496 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine |
| SMILES | C/C=C\C(=C\C)\N=C(/C)CCC |
| InChI | InChI=1S/C11H19N/c1-5-8-10(4)12-11(7-3)9-6-2/h6-7,9H,5,8H2,1-4H3/b9-6-,11-7-,12-10+ |
| InChIKey | GFIXKVPEBGZONO-ABEILSIJSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|