C14H27N — CID 153342646
ethane;N-[(1Z,4Z)-2-methylhexa-1,4-dienyl]pentan-2-imine (PubChem CID 153342646) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;N-[(1Z,4Z)-2-methylhexa-1,4-dienyl]pentan-2-imine.
| Compound Name | ethane;N-[(1Z,4Z)-2-methylhexa-1,4-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 153342646 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;N-[(1Z,4Z)-2-methylhexa-1,4-dienyl]pentan-2-imine |
| SMILES | C/C=C\C/C(C)=C\N=C(/C)CCC.CC |
| InChI | InChI=1S/C12H21N.C2H6/c1-5-7-9-11(3)10-13-12(4)8-6-2;1-2/h5,7,10H,6,8-9H2,1-4H3;1-2H3/b7-5-,11-10-,13-12+; |
| InChIKey | UKZUGRNJZXNHNQ-WHNGEFPLSA-N |
| XLogP | 5.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|