About methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine
methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine (PubChem CID 172950111) has the molecular formula C14H36N2
and a molecular weight of 232.46 g/mol. Its IUPAC name is methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine.
Molecular Properties
| Compound Name | methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine |
| PubChem CID | 172950111 |
| Molecular Formula | C14H36N2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.29 |
| IUPAC Name | methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine |
| SMILES | C.C.C.C.CCC/C(C)=N/N=C(\C)CCC |
| InChI | InChI=1S/C10H20N2.4CH4/c1-5-7-9(3)11-12-10(4)8-6-2;;;;/h5-8H2,1-4H3;4*1H4/b11-9+,12-10+;;;; |
| InChIKey | OCYRQXWLEZJCFP-GETIWUENSA-N |
| XLogP | 5.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine?
The IUPAC name of methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine (CID 172950111) is methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine.
What is the SMILES notation for methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine?
The canonical SMILES for methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine is C.C.C.C.CCC/C(C)=N/N=C(\C)CCC.
What is the InChIKey of methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine?
The InChIKey is OCYRQXWLEZJCFP-GETIWUENSA-N. The full InChI is InChI=1S/C10H20N2.4CH4/c1-5-7-9(3)11-12-10(4)8-6-2;;;;/h5-8H2,1-4H3;4*1H4/b11-9+,12-10+;;;;.
What are the key properties of methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine?
methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine has a molecular weight of 232.46 g/mol, XLogP of 5.97, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(E)-N-[(E)-pentan-2-ylideneamino]pentan-2-imine is sourced from PubChem (CID 172950111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).