C11H20 — CID 142206656
(2Z,5Z)-5-propylocta-2,5-diene (PubChem CID 142206656) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (2Z,5Z)-5-propylocta-2,5-diene.
| Compound Name | (2Z,5Z)-5-propylocta-2,5-diene |
|---|---|
| PubChem CID | 142206656 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (2Z,5Z)-5-propylocta-2,5-diene |
| SMILES | C/C=C\C/C(=C\CC)CCC |
| InChI | InChI=1S/C11H20/c1-4-7-10-11(8-5-2)9-6-3/h4,7-8H,5-6,9-10H2,1-3H3/b7-4-,11-8- |
| InChIKey | NZYDQMMNCZOSHC-XGBXBTFKSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|