C8H13Br — CID 143426867
(2Z,5E)-5-bromoocta-2,5-diene (PubChem CID 143426867) has the molecular formula C8H13Br and a molecular weight of 189.10 g/mol. Its IUPAC name is (2Z,5E)-5-bromoocta-2,5-diene.
| Compound Name | (2Z,5E)-5-bromoocta-2,5-diene |
|---|---|
| PubChem CID | 143426867 |
| Molecular Formula | C8H13Br |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | (2Z,5E)-5-bromoocta-2,5-diene |
| SMILES | C/C=C\C/C(Br)=C\CC |
| InChI | InChI=1S/C8H13Br/c1-3-5-7-8(9)6-4-2/h3,5-6H,4,7H2,1-2H3/b5-3-,8-6+ |
| InChIKey | JOBQNGVVLPOCGP-CUKJDEOPSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|