C19H31BrO3 — CID 11211384
methyl (12Z,15Z)-13-bromo-9-oxooctadeca-12,15-dienoate (PubChem CID 11211384) has the molecular formula C19H31BrO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is methyl (12Z,15Z)-13-bromo-9-oxooctadeca-12,15-dienoate.
| Compound Name | methyl (12Z,15Z)-13-bromo-9-oxooctadeca-12,15-dienoate |
|---|---|
| PubChem CID | 11211384 |
| Molecular Formula | C19H31BrO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | methyl (12Z,15Z)-13-bromo-9-oxooctadeca-12,15-dienoate |
| SMILES | CC/C=C\C/C(Br)=C/CCC(=O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H31BrO3/c1-3-4-8-12-17(20)13-11-15-18(21)14-9-6-5-7-10-16-19(22)23-2/h4,8,13H,3,5-7,9-12,14-16H2,1-2H3/b8-4-,17-13- |
| InChIKey | BJKOMHBYXKKCEC-FHEUVEDYSA-N |
| XLogP | 5.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|