C23H44O — CID 174283265
(3E,21E)-tricosa-3,21-dien-4-ol (PubChem CID 174283265) has the molecular formula C23H44O and a molecular weight of 336.60 g/mol. Its IUPAC name is (3E,21E)-tricosa-3,21-dien-4-ol.
| Compound Name | (3E,21E)-tricosa-3,21-dien-4-ol |
|---|---|
| PubChem CID | 174283265 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | (3E,21E)-tricosa-3,21-dien-4-ol |
| SMILES | C/C=C/CCCCCCCCCCCCCCCC/C(O)=C\CC |
| InChI | InChI=1S/C23H44O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-23(24)21-4-2/h3,5,21,24H,4,6-20,22H2,1-2H3/b5-3+,23-21+ |
| InChIKey | XGSHCASVYBXRDT-GZBCJVBHSA-N |
| XLogP | 8.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|