About [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten
[(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten (PubChem CID 177221584) has the molecular formula C21H44NO2W-
and a molecular weight of 526.43 g/mol. Its IUPAC name is [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten.
Molecular Properties
| Compound Name | [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten |
| PubChem CID | 177221584 |
| Molecular Formula | C21H44NO2W- |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten |
| SMILES | CC/C=C(/O)CCCCCCCCCCCCCCCC[NH-].CO.[W] |
| InChI | InChI=1S/C20H40NO.CH4O.W/c1-2-17-20(22)18-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19-21;1-2;/h17,21-22H,2-16,18-19H2,1H3;2H,1H3;/q-1;;/b20-17+;; |
| InChIKey | XHVVCQIKPWGUAH-NNIZZXHBSA-N |
| XLogP | 7.35 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten?
The IUPAC name of [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten (CID 177221584) is [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten.
What is the SMILES notation for [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten?
The canonical SMILES for [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten is CC/C=C(/O)CCCCCCCCCCCCCCCC[NH-].CO.[W].
What is the InChIKey of [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten?
The InChIKey is XHVVCQIKPWGUAH-NNIZZXHBSA-N. The full InChI is InChI=1S/C20H40NO.CH4O.W/c1-2-17-20(22)18-15-13-11-9-7-5-3-4-6-8-10-12-14-16-19-21;1-2;/h17,21-22H,2-16,18-19H2,1H3;2H,1H3;/q-1;;/b20-17+;;.
What are the key properties of [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten?
[(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten has a molecular weight of 526.43 g/mol, XLogP of 7.35, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-17-hydroxyicos-17-enyl]azanide;methanol;tungsten is sourced from PubChem (CID 177221584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).