About 4-hydroxyicos-3-enoic acid
4-hydroxyicos-3-enoic acid (PubChem CID 88697964) has the molecular formula C20H38O3
and a molecular weight of 326.52 g/mol. Its IUPAC name is 4-hydroxyicos-3-enoic acid.
Molecular Properties
| Compound Name | 4-hydroxyicos-3-enoic acid |
| PubChem CID | 88697964 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | 4-hydroxyicos-3-enoic acid |
| SMILES | CCCCCCCCCCCCCCCCC(O)=CCC(=O)O |
| InChI | InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20(22)23/h17,21H,2-16,18H2,1H3,(H,22,23) |
| InChIKey | RMXGBYMIDPSURW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyicos-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyicos-3-enoic acid?
The IUPAC name of 4-hydroxyicos-3-enoic acid (CID 88697964) is 4-hydroxyicos-3-enoic acid.
What is the SMILES notation for 4-hydroxyicos-3-enoic acid?
The canonical SMILES for 4-hydroxyicos-3-enoic acid is CCCCCCCCCCCCCCCCC(O)=CCC(=O)O.
What is the InChIKey of 4-hydroxyicos-3-enoic acid?
The InChIKey is RMXGBYMIDPSURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)17-18-20(22)23/h17,21H,2-16,18H2,1H3,(H,22,23).
What are the key properties of 4-hydroxyicos-3-enoic acid?
4-hydroxyicos-3-enoic acid has a molecular weight of 326.52 g/mol, XLogP of 6.77, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyicos-3-enoic acid is sourced from PubChem (CID 88697964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).