About sodium 4-hydroxyhept-4-enoate
sodium 4-hydroxyhept-4-enoate (PubChem CID 88698086) has the molecular formula C7H11NaO3
and a molecular weight of 166.15 g/mol. Its IUPAC name is sodium 4-hydroxyhept-4-enoate.
Molecular Properties
| Compound Name | sodium 4-hydroxyhept-4-enoate |
| PubChem CID | 88698086 |
| Molecular Formula | C7H11NaO3 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | sodium 4-hydroxyhept-4-enoate |
| SMILES | CCC=C(O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12O3.Na/c1-2-3-6(8)4-5-7(9)10;/h3,8H,2,4-5H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | NTHKZQANEFRZPJ-UHFFFAOYSA-M |
| XLogP | -2.63 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-hydroxyhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-hydroxyhept-4-enoate?
The IUPAC name of sodium 4-hydroxyhept-4-enoate (CID 88698086) is sodium 4-hydroxyhept-4-enoate.
What is the SMILES notation for sodium 4-hydroxyhept-4-enoate?
The canonical SMILES for sodium 4-hydroxyhept-4-enoate is CCC=C(O)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium 4-hydroxyhept-4-enoate?
The InChIKey is NTHKZQANEFRZPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12O3.Na/c1-2-3-6(8)4-5-7(9)10;/h3,8H,2,4-5H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 4-hydroxyhept-4-enoate?
sodium 4-hydroxyhept-4-enoate has a molecular weight of 166.15 g/mol, XLogP of -2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-hydroxyhept-4-enoate is sourced from PubChem (CID 88698086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).