C16H30O — CID 154698399
(3Z)-hexadeca-3,15-dien-4-ol (PubChem CID 154698399) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (3Z)-hexadeca-3,15-dien-4-ol.
| Compound Name | (3Z)-hexadeca-3,15-dien-4-ol |
|---|---|
| PubChem CID | 154698399 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (3Z)-hexadeca-3,15-dien-4-ol |
| SMILES | C=CCCCCCCCCCC/C(O)=C/CC |
| InChI | InChI=1S/C16H30O/c1-3-5-6-7-8-9-10-11-12-13-15-16(17)14-4-2/h3,14,17H,1,4-13,15H2,2H3/b16-14- |
| InChIKey | ZWDXMVAOWAPDDP-PEZBUJJGSA-N |
| XLogP | 5.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|