C15H23N — CID 135210367
N-[(1Z,4E)-3-methylidene-4-prop-1-en-2-ylhexa-1,4-dienyl]pentan-2-imine (PubChem CID 135210367) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is N-[(1Z,4E)-3-methylidene-4-prop-1-en-2-ylhexa-1,4-dienyl]pentan-2-imine.
| Compound Name | N-[(1Z,4E)-3-methylidene-4-prop-1-en-2-ylhexa-1,4-dienyl]pentan-2-imine |
|---|---|
| PubChem CID | 135210367 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-[(1Z,4E)-3-methylidene-4-prop-1-en-2-ylhexa-1,4-dienyl]pentan-2-imine |
| SMILES | C=C(C)/C(=C\C)C(=C)/C=C\N=C(/C)CCC |
| InChI | InChI=1S/C15H23N/c1-7-9-14(6)16-11-10-13(5)15(8-2)12(3)4/h8,10-11H,3,5,7,9H2,1-2,4,6H3/b11-10-,15-8+,16-14+ |
| InChIKey | BCSXNBOYWNRMSZ-YVEGDTTHSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|