C11H19N — CID 170028248
3-methyl-2-prop-1-en-2-yl-N-propylbuta-1,3-dien-1-amine (PubChem CID 170028248) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3-methyl-2-prop-1-en-2-yl-N-propylbuta-1,3-dien-1-amine.
| Compound Name | 3-methyl-2-prop-1-en-2-yl-N-propylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 170028248 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3-methyl-2-prop-1-en-2-yl-N-propylbuta-1,3-dien-1-amine |
| SMILES | C=C(C)C(=CNCCC)C(=C)C |
| InChI | InChI=1S/C11H19N/c1-6-7-12-8-11(9(2)3)10(4)5/h8,12H,2,4,6-7H2,1,3,5H3 |
| InChIKey | FLJNISVLXAORLL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|