C33H61NO3 — CID 142177242
N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;3-hydroxy-4,4,6-trimethyl-5-oxononanal;(E)-5-methylnon-3-ene (PubChem CID 142177242) has the molecular formula C33H61NO3 and a molecular weight of 519.86 g/mol. Its IUPAC name is N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;3-hydroxy-4,4,6-trimethyl-5-oxononanal;(E)-5-methylnon-3-ene.
| Compound Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;3-hydroxy-4,4,6-trimethyl-5-oxononanal;(E)-5-methylnon-3-ene |
|---|---|
| PubChem CID | 142177242 |
| Molecular Formula | C33H61NO3 |
| Molecular Weight | 519.86 g/mol |
| Exact Mass | 519.47 |
| IUPAC Name | N-[(2Z,4Z)-hexa-2,4-dien-3-yl]pentan-2-imine;3-hydroxy-4,4,6-trimethyl-5-oxononanal;(E)-5-methylnon-3-ene |
| SMILES | C/C=C\C(=C\C)\N=C(/C)CCC.CC/C=C/C(C)CCCC.CCCC(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C12H22O3.C11H19N.C10H20/c1-5-6-9(2)11(15)12(3,4)10(14)7-8-13;1-5-8-10(4)12-11(7-3)9-6-2;1-4-6-8-10(3)9-7-5-2/h8-10,14H,5-7H2,1-4H3;6-7,9H,5,8H2,1-4H3;6,8,10H,4-5,7,9H2,1-3H3/b;9-6-,11-7-,12-10+;8-6+ |
| InChIKey | OLWYKTFMLSFHAN-VUHKPNKKSA-N |
| XLogP | 9.47 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.86 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|