C21H37NO5 — CID 88941998
(Z)-14-amino-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5,15-dioxohexadec-12-enal (PubChem CID 88941998) has the molecular formula C21H37NO5 and a molecular weight of 383.53 g/mol. Its IUPAC name is (Z)-14-amino-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5,15-dioxohexadec-12-enal.
| Compound Name | (Z)-14-amino-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5,15-dioxohexadec-12-enal |
|---|---|
| PubChem CID | 88941998 |
| Molecular Formula | C21H37NO5 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | (Z)-14-amino-3,7-dihydroxy-4,4,6,8,12-pentamethyl-5,15-dioxohexadec-12-enal |
| SMILES | CC(=O)C(N)/C=C(/C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C21H37NO5/c1-13(12-17(22)16(4)24)8-7-9-14(2)19(26)15(3)20(27)21(5,6)18(25)10-11-23/h11-12,14-15,17-19,25-26H,7-10,22H2,1-6H3/b13-12- |
| InChIKey | WHABLVZVBZQRKD-SEYXRHQNSA-N |
| XLogP | 2.20 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|