C26H42N2O4S — CID 88941997
(12Z,15E)-14-amino-3,7-dihydroxy-4,4,6,8,12,15-hexamethyl-16-(2-methyl-1,3-thiazol-4-yl)-5-oxohexadeca-12,15-dienal (PubChem CID 88941997) has the molecular formula C26H42N2O4S and a molecular weight of 478.70 g/mol. Its IUPAC name is (12Z,15E)-14-amino-3,7-dihydroxy-4,4,6,8,12,15-hexamethyl-16-(2-methyl-1,3-thiazol-4-yl)-5-oxohexadeca-12,15-dienal.
| Compound Name | (12Z,15E)-14-amino-3,7-dihydroxy-4,4,6,8,12,15-hexamethyl-16-(2-methyl-1,3-thiazol-4-yl)-5-oxohexadeca-12,15-dienal |
|---|---|
| PubChem CID | 88941997 |
| Molecular Formula | C26H42N2O4S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (12Z,15E)-14-amino-3,7-dihydroxy-4,4,6,8,12,15-hexamethyl-16-(2-methyl-1,3-thiazol-4-yl)-5-oxohexadeca-12,15-dienal |
| SMILES | C/C(=C/C(N)/C(C)=C/c1csc(C)n1)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC=O |
| InChI | InChI=1S/C26H42N2O4S/c1-16(13-22(27)18(3)14-21-15-33-20(5)28-21)9-8-10-17(2)24(31)19(4)25(32)26(6,7)23(30)11-12-29/h12-15,17,19,22-24,30-31H,8-11,27H2,1-7H3/b16-13-,18-14+ |
| InChIKey | BBNSPGOSXKPKHO-ODINJJDSSA-N |
| XLogP | 4.48 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|