C27H44N2O5S — CID 88999251
11-(2,3-dimethyloxiran-2-yl)-3,7-dihydroxy-4,4,6,8-tetramethyl-N-[(E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5-oxoundecanamide (PubChem CID 88999251) has the molecular formula C27H44N2O5S and a molecular weight of 508.73 g/mol. Its IUPAC name is 11-(2,3-dimethyloxiran-2-yl)-3,7-dihydroxy-4,4,6,8-tetramethyl-N-[(E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5-oxoundecanamide.
| Compound Name | 11-(2,3-dimethyloxiran-2-yl)-3,7-dihydroxy-4,4,6,8-tetramethyl-N-[(E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5-oxoundecanamide |
|---|---|
| PubChem CID | 88999251 |
| Molecular Formula | C27H44N2O5S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 11-(2,3-dimethyloxiran-2-yl)-3,7-dihydroxy-4,4,6,8-tetramethyl-N-[(E)-2-methyl-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enyl]-5-oxoundecanamide |
| SMILES | C/C(=C\c1csc(C)n1)CNC(=O)CC(O)C(C)(C)C(=O)C(C)C(O)C(C)CCCC1(C)OC1C |
| InChI | InChI=1S/C27H44N2O5S/c1-16(12-21-15-35-20(5)29-21)14-28-23(31)13-22(30)26(6,7)25(33)18(3)24(32)17(2)10-9-11-27(8)19(4)34-27/h12,15,17-19,22,24,30,32H,9-11,13-14H2,1-8H3,(H,28,31)/b16-12+ |
| InChIKey | CLQYHHYZJCWGCM-FOWTUZBSSA-N |
| XLogP | 4.30 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|