C28H46N2O4S — CID 59990602
(6R,7S,8S,12Z,16E)-15-amino-3-hydroxy-4,4,6,7,8,12,16-heptamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienoic acid (PubChem CID 59990602) has the molecular formula C28H46N2O4S and a molecular weight of 506.75 g/mol. Its IUPAC name is (6R,7S,8S,12Z,16E)-15-amino-3-hydroxy-4,4,6,7,8,12,16-heptamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienoic acid.
| Compound Name | (6R,7S,8S,12Z,16E)-15-amino-3-hydroxy-4,4,6,7,8,12,16-heptamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienoic acid |
|---|---|
| PubChem CID | 59990602 |
| Molecular Formula | C28H46N2O4S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | (6R,7S,8S,12Z,16E)-15-amino-3-hydroxy-4,4,6,7,8,12,16-heptamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadeca-12,16-dienoic acid |
| SMILES | C/C(=C/CC(N)/C(C)=C/c1csc(C)n1)CCC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)C(O)CC(=O)O |
| InChI | InChI=1S/C28H46N2O4S/c1-17(12-13-24(29)19(3)14-23-16-35-22(6)30-23)10-9-11-18(2)20(4)21(5)27(34)28(7,8)25(31)15-26(32)33/h12,14,16,18,20-21,24-25,31H,9-11,13,15,29H2,1-8H3,(H,32,33)/b17-12-,19-14+/t18-,20-,21+,24?,25?/m0/s1 |
| InChIKey | KCAZESQISGRFPS-TUAIUGDASA-N |
| XLogP | 6.03 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|